CAS 73268-21-0 is the registry number for 8-Chloro-4,5-dihydro-1-methyl-6H-(1,2,4)triazolo(4,3-a)(1,4)benzodiazepin-6-one. Offered by: TRC. Available pack sizes: 1g.
8-chloro-1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-6-one (CAS 73268-21-0) is a chemical compound with the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. IUPAC name: 8-chloro-1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-6-one. InChIKey: LHUBAPWIYFPXRQ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN4O |
|---|---|
| Molecular weight | 248.67 g/mol |
| IUPAC name | 8-chloro-1-methyl-4,5-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-6-one |
| InChIKey | LHUBAPWIYFPXRQ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=O)NC2 |
Computed by PubChem (NCBI)