CAS 1396777-75-5 appears in our catalog under these names: 6'-Bromo-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinolin]-1'-one, 98%, 98%, 6'-Bromo-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinolin]-1'-one, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
6-bromospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (CAS 1396777-75-5) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 6-bromospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one. InChIKey: LLNXYASMZYLOCI-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 6-bromospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| InChIKey | LLNXYASMZYLOCI-UHFFFAOYSA-N |
| SMILES | C1CC12CNC(=O)C3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)