CAS 1396967-59-1 is the registry number for 3-Carbamoyl-2-((2-chlorophenyl)formamido)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-amino-2-[(2-chlorobenzoyl)amino]-4-oxobutanoic acid (CAS 1396967-59-1) is a chemical compound with the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. IUPAC name: 4-amino-2-[(2-chlorobenzoyl)amino]-4-oxobutanoic acid. InChIKey: ZHHYFQDAWUJSPO-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O4 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | 4-amino-2-[(2-chlorobenzoyl)amino]-4-oxobutanoic acid |
| InChIKey | ZHHYFQDAWUJSPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC(CC(=O)N)C(=O)O)Cl |
Computed by PubChem (NCBI)