Products 1595286-68-2
CAS 1595286-68-2 is the registry number for 2-Chloro-2-(4'-carboxyphenylhydrazono)acetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
4-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]benzoic acid (CAS 1595286-68-2) is a chemical compound with the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. IUPAC name: 4-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]benzoic acid. InChIKey: SFMWCVYUWKVGTI-ZROIWOOFSA-N.
| Molecular formula | C11H11ClN2O4 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | 4-[(2Z)-2-(1-chloro-2-ethoxy-2-oxoethylidene)hydrazinyl]benzoic acid |
| InChIKey | SFMWCVYUWKVGTI-ZROIWOOFSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC=C(C=C1)C(=O)O)/Cl |
Computed by PubChem (NCBI)