CAS 827605-47-0 is the registry number for 2-Chloro-5,6,7-trimethoxyquinazolin-4(1H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5,6,7-trimethoxy-3H-quinazolin-4-one (CAS 827605-47-0) is a chemical compound with the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. IUPAC name: 2-chloro-5,6,7-trimethoxy-3H-quinazolin-4-one. InChIKey: GKPRWIVTCJUQHM-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O4 |
|---|---|
| Molecular weight | 270.67 g/mol |
| IUPAC name | 2-chloro-5,6,7-trimethoxy-3H-quinazolin-4-one |
| InChIKey | GKPRWIVTCJUQHM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)N=C(NC2=O)Cl)OC)OC |
Computed by PubChem (NCBI)