CAS 1397004-77-1 appears in our catalog under these names: 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]-4-methylpentanoic acid, 95%, 2-((1,1-Dioxo-1,2-benzothiazol-3-yl)amino)-4-methylpentanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentanoic acid (CAS 1397004-77-1) is a chemical compound with the molecular formula C13H16N2O4S and a molecular weight of 296.34 g/mol. IUPAC name: 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentanoic acid. InChIKey: XUDKGIYXQYIDSV-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4S |
|---|---|
| Molecular weight | 296.34 g/mol |
| IUPAC name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentanoic acid |
| InChIKey | XUDKGIYXQYIDSV-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)N=C1C2=CC=CC=C2S(=O)(=O)N1 |
Computed by PubChem (NCBI)