CAS 1774900-87-6 is the registry number for tert-Butyl 1-methyl-1h-4,1,2-benzothiadiazine-3-carboxylate 4,4-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 1-methyl-4,4-dioxo-4lambda6,1,2-benzothiadiazine-3-carboxylate (CAS 1774900-87-6) is a chemical compound with the molecular formula C13H16N2O4S and a molecular weight of 296.34 g/mol. IUPAC name: tert-butyl 1-methyl-4,4-dioxo-4lambda6,1,2-benzothiadiazine-3-carboxylate. InChIKey: MDVHGKKQLPGABX-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4S |
|---|---|
| Molecular weight | 296.34 g/mol |
| IUPAC name | tert-butyl 1-methyl-4,4-dioxo-4lambda6,1,2-benzothiadiazine-3-carboxylate |
| InChIKey | MDVHGKKQLPGABX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NN(C2=CC=CC=C2S1(=O)=O)C |
Computed by PubChem (NCBI)