Products 1951442-16-2
CAS 1951442-16-2 is the registry number for (2-Amino-benzothiazol-6-yl)-acetic acid ethyl ester acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Acetic acid;ethyl 2-(2-amino-1,3-benzothiazol-6-yl)acetate (CAS 1951442-16-2) is a chemical compound with the molecular formula C13H16N2O4S and a molecular weight of 296.34 g/mol. IUPAC name: acetic acid;ethyl 2-(2-amino-1,3-benzothiazol-6-yl)acetate. InChIKey: LZGAWCFFWRVOQB-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4S |
|---|---|
| Molecular weight | 296.34 g/mol |
| IUPAC name | acetic acid;ethyl 2-(2-amino-1,3-benzothiazol-6-yl)acetate |
| InChIKey | LZGAWCFFWRVOQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC2=C(C=C1)N=C(S2)N.CC(=O)O |
Computed by PubChem (NCBI)