Products 1397181-04-2
CAS 1397181-04-2 is the registry number for 2-(3,5-Difluorophenyl)oxazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-difluorophenyl)-1,3-oxazole-5-carbaldehyde (CAS 1397181-04-2) is a chemical compound with the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-1,3-oxazole-5-carbaldehyde. InChIKey: QMXSXHRPMOKOCQ-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO2 |
|---|---|
| Molecular weight | 209.15 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-1,3-oxazole-5-carbaldehyde |
| InChIKey | QMXSXHRPMOKOCQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=NC=C(O2)C=O |
Computed by PubChem (NCBI)