CAS 154505-91-6 appears in our catalog under these names: 1-(3,4-Difluorophenyl)-1H-pyrrole-2,5-dione, 97%, 1-(3,4-Difluorophenyl)-1H-pyrrole-2,5-dione, 95-<97%. Offered by: Chemat Brand, Hoffman Fine Chemicals. Available pack sizes: on request, 2,5g, 5g, 10g, 25g, 50g.
1-(3,4-difluorophenyl)pyrrole-2,5-dione (CAS 154505-91-6) is a chemical compound with the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. IUPAC name: 1-(3,4-difluorophenyl)pyrrole-2,5-dione. InChIKey: BVNOVCCMWCOYQL-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO2 |
|---|---|
| Molecular weight | 209.15 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)pyrrole-2,5-dione |
| InChIKey | BVNOVCCMWCOYQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C=CC2=O)F)F |
Computed by PubChem (NCBI)