CAS 6954-65-0 appears in our catalog under these names: N-(2,4-Difluorophenyl)maleimide, 95%, 1-(2,4-Difluorophenyl)-1H-pyrrole-2,5-dione, 95+%, 1-(2,4-Difluorophenyl)-1H-pyrrole-2,5-dione, ≥95%, ≥95%, 1-(2,4-Difluorophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
1-(2,4-difluorophenyl)pyrrole-2,5-dione (CAS 6954-65-0) is a chemical compound with the molecular formula C10H5F2NO2 and a molecular weight of 209.15 g/mol. IUPAC name: 1-(2,4-difluorophenyl)pyrrole-2,5-dione. InChIKey: WQAYULVQTJAUMD-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO2 |
|---|---|
| Molecular weight | 209.15 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)pyrrole-2,5-dione |
| InChIKey | WQAYULVQTJAUMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)