Products 1397200-83-7

CAS 1397200-83-7 is the registry number for Mefenamic Acid-d3 (major), >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

2-(2,3,4-trideuterio-5,6-dimethylanilino)benzoic acid (CAS 1397200-83-7) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 244.30 g/mol. IUPAC name: 2-(2,3,4-trideuterio-5,6-dimethylanilino)benzoic acid. InChIKey: HYYBABOKPJLUIN-DINNLGBQSA-N.

Identity
Molecular formulaC15H15NO2
Molecular weight244.30 g/mol
IUPAC name2-(2,3,4-trideuterio-5,6-dimethylanilino)benzoic acid
InChIKeyHYYBABOKPJLUIN-DINNLGBQSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])NC2=CC=CC=C2C(=O)O)C)C)[2H]

Computed by PubChem (NCBI)