CAS 1397200-83-7 is the registry number for Mefenamic Acid-d3 (major), >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
2-(2,3,4-trideuterio-5,6-dimethylanilino)benzoic acid (CAS 1397200-83-7) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 244.30 g/mol. IUPAC name: 2-(2,3,4-trideuterio-5,6-dimethylanilino)benzoic acid. InChIKey: HYYBABOKPJLUIN-DINNLGBQSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 244.30 g/mol |
| IUPAC name | 2-(2,3,4-trideuterio-5,6-dimethylanilino)benzoic acid |
| InChIKey | HYYBABOKPJLUIN-DINNLGBQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])NC2=CC=CC=C2C(=O)O)C)C)[2H] |
Computed by PubChem (NCBI)