CAS 1216745-79-7 appears in our catalog under these names: Mefenamic Acid-d4, Mefenamic-d4 Acid, >95% (HPLC), Mefenamic-d4 Acid (benzoic-3,4,5,6-d4), 98 atom % D, min 98% Chemical Purity, Mefenamic acid D4, Mefenamic acid-d4, 98.0%. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 5mg, 1 mg, 5 mg.
2,3,4,5-tetradeuterio-6-(2,3-dimethylanilino)benzoic acid (CAS 1216745-79-7) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 245.31 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(2,3-dimethylanilino)benzoic acid. InChIKey: HYYBABOKPJLUIN-KNIGXJNHSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 245.31 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(2,3-dimethylanilino)benzoic acid |
| InChIKey | HYYBABOKPJLUIN-KNIGXJNHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)NC2=CC=CC(=C2C)C)[2H])[2H] |
Computed by PubChem (NCBI)