CAS 1397206-82-4 is the registry number for Benz(e)acephenanthrylene-13C6. Offered by: TRC. Available pack sizes: 25mg.
Benzo[b]fluoranthene is an ortho- and peri-fused polycyclic arene that consists of a benzene ring fused with a acephenanthrylene ring. It has a role as a mutagen.
Source: ChEBI
| Molecular formula | C20H12 |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | pentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(19),2(7),3,5,8(20),9,11,13,15,17-decaene |
| InChIKey | FTOVXSOBNPWTSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3=C4C(=CC=C3)C5=CC=CC=C5C4=CC2=C1 |
Computed by PubChem (NCBI)