CAS 199-54-2 is the registry number for Benz(e)aceanthrylene. Offered by: Chemat Brand. Available pack sizes: on request.
Pentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(19),2,4,6,8,10,12(20),13,15,17-decaene (CAS 199-54-2) is a chemical compound with the molecular formula C20H12 and a molecular weight of 252.3 g/mol. IUPAC name: pentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(19),2,4,6,8,10,12(20),13,15,17-decaene. InChIKey: YPMKRLARTMANBR-UHFFFAOYSA-N.
| Molecular formula | C20H12 |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | pentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(19),2,4,6,8,10,12(20),13,15,17-decaene |
| InChIKey | YPMKRLARTMANBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC4=C3C2=CC5=CC=CC=C45 |
Computed by PubChem (NCBI)