CAS 93952-01-3 appears in our catalog under these names: Benzo(k)fluoranthene-d12, >95% (HPLC), Benzo(k)fluoranthene D12, Benzo(k)fluoranthene D12 10 µg/mL in Cyclohexane, Benzo(k)fluoranthene-d12, 98 atom % D, min 98% Chemical Purity, Benzo[k]fluoranthene-d12, 99.7%. Offered by: TRC, Dr. Ehrenstorfer, CDN, MedChemExpress. Available pack sizes: 10mg, 1ml, 0,01g, 1 mg.
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[k]fluoranthene (CAS 93952-01-3) is a chemical compound with the molecular formula C20H12 and a molecular weight of 264.4 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[k]fluoranthene. InChIKey: HAXBIWFMXWRORI-AQZSQYOVSA-N.
| Molecular formula | C20H12 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[k]fluoranthene |
| InChIKey | HAXBIWFMXWRORI-AQZSQYOVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C3C4=C(C(=C(C5=C4C(=C(C(=C5[2H])[2H])[2H])C3=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)