CAS 1397236-31-5 is the registry number for Thymine-2-13C-1,3-15N2, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 2,5mg, 50mg.
5-methyl-(213C,1,3-15N2)1H-pyrimidine-2,4-dione (CAS 1397236-31-5) is a chemical compound with the molecular formula C5H6N2O2 and a molecular weight of 129.09 g/mol. IUPAC name: 5-methyl-(213C,1,3-15N2)1H-pyrimidine-2,4-dione. InChIKey: RWQNBRDOKXIBIV-SVFBATFISA-N.
| Molecular formula | C5H6N2O2 |
|---|---|
| Molecular weight | 129.09 g/mol |
| IUPAC name | 5-methyl-(213C,1,3-15N2)1H-pyrimidine-2,4-dione |
| InChIKey | RWQNBRDOKXIBIV-SVFBATFISA-N |
| SMILES | CC1=C[15NH][13C](=O)[15NH]C1=O |
Computed by PubChem (NCBI)