Products 156054-85-2
CAS 156054-85-2 appears in our catalog under these names: Thymine–d4, THYMINE-METHYL-D3-6-D, 98 ATOM % D, Thymine-d4-1, 99.47%. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 50mg, 1G, 10 mg, 100 mg, 50 mg.
6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione (CAS 156054-85-2) is a chemical compound with the molecular formula C5H6N2O2 and a molecular weight of 130.14 g/mol. IUPAC name: 6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione. InChIKey: RWQNBRDOKXIBIV-MZCSYVLQSA-N.
| Molecular formula | C5H6N2O2 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | 6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | RWQNBRDOKXIBIV-MZCSYVLQSA-N |
| SMILES | [2H]C1=C(C(=O)NC(=O)N1)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
5-(~2~H_3_)Methyl(6-~2~H)pyrimidine-2,4(1H,3H)-dione, thymine-d4, Thymine-d4 (methyl-d3,6-d1), Thymine-methyl-d3-6-d, 6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione, Thymine-d4-1, orb2300140, 5-(methyl-d3)pyrimidine-2,4(1H,3H)-dione-6-d, Thymine-d4 (methyl-d3,6-d1), 98 atom % D, >=99% (CP)