Products 200496-79-3
CAS 200496-79-3 appears in our catalog under these names: Thymine-d4, Thymine-alpha,alpha,alpha,6-d4, 98 atom % D, min 98% Chemical Purity, Thymine-d4, 98%. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 0,5g, 250mg, 50 mg, 25 mg.
6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione (CAS 200496-79-3) is a chemical compound with the molecular formula C5H6N2O2 and a molecular weight of 130.14 g/mol. IUPAC name: 6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione. InChIKey: RWQNBRDOKXIBIV-MZCSYVLQSA-N.
| Molecular formula | C5H6N2O2 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | 6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | RWQNBRDOKXIBIV-MZCSYVLQSA-N |
| SMILES | [2H]C1=C(C(=O)NC(=O)N1)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
5-(~2~H_3_)Methyl(6-~2~H)pyrimidine-2,4(1H,3H)-dione, thymine-d4, Thymine-d4 (methyl-d3,6-d1), Thymine-methyl-d3-6-d, 6-deuterio-5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione, Thymine-d4-1, orb2300140, 5-(methyl-d3)pyrimidine-2,4(1H,3H)-dione-6-d, Thymine-d4 (methyl-d3,6-d1), 98 atom % D, >=99% (CP)