CAS 1397706-42-1 is the registry number for 2-Chlorobenzo[d]oxazole-6-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1,3-benzoxazole-6-carbonitrile (CAS 1397706-42-1) is a chemical compound with the molecular formula C8H3ClN2O and a molecular weight of 178.57 g/mol. IUPAC name: 2-chloro-1,3-benzoxazole-6-carbonitrile. InChIKey: ZLSAQCPQVQLJCJ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2O |
|---|---|
| Molecular weight | 178.57 g/mol |
| IUPAC name | 2-chloro-1,3-benzoxazole-6-carbonitrile |
| InChIKey | ZLSAQCPQVQLJCJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)OC(=N2)Cl |
Computed by PubChem (NCBI)