CAS 2092481-30-4 is the registry number for 4-Chlorofuro[2,3-b]pyridine-2-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chlorofuro[2,3-b]pyridine-2-carbonitrile (CAS 2092481-30-4) is a chemical compound with the molecular formula C8H3ClN2O and a molecular weight of 178.57 g/mol. IUPAC name: 4-chlorofuro[2,3-b]pyridine-2-carbonitrile. InChIKey: RMOVUVLCHATTNE-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2O |
|---|---|
| Molecular weight | 178.57 g/mol |
| IUPAC name | 4-chlorofuro[2,3-b]pyridine-2-carbonitrile |
| InChIKey | RMOVUVLCHATTNE-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Cl)C=C(O2)C#N |
Computed by PubChem (NCBI)