CAS 33652-89-0 appears in our catalog under these names: 5-Chlorobenzo(d)oxazole-2-carbonitrile, 95+%, 5-Chloro-1,3-benzoxazole-2-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-1,3-benzoxazole-2-carbonitrile (CAS 33652-89-0) is a chemical compound with the molecular formula C8H3ClN2O and a molecular weight of 178.57 g/mol. IUPAC name: 5-chloro-1,3-benzoxazole-2-carbonitrile. InChIKey: PNCPFMQXBPUCMF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2O |
|---|---|
| Molecular weight | 178.57 g/mol |
| IUPAC name | 5-chloro-1,3-benzoxazole-2-carbonitrile |
| InChIKey | PNCPFMQXBPUCMF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(O2)C#N |
Computed by PubChem (NCBI)