CAS 13980-77-3 is the registry number for 1-(4-Methylphenyl)-1H-1,2,3,4-tetrazole-5-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(4-methylphenyl)-2H-tetrazole-5-thione (CAS 13980-77-3) is a chemical compound with the molecular formula C8H8N4S and a molecular weight of 192.24 g/mol. IUPAC name: 1-(4-methylphenyl)-2H-tetrazole-5-thione. InChIKey: VBCMZLIIYLERKB-UHFFFAOYSA-N.
| Molecular formula | C8H8N4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 1-(4-methylphenyl)-2H-tetrazole-5-thione |
| InChIKey | VBCMZLIIYLERKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=S)N=NN2 |
Computed by PubChem (NCBI)