Products 1398065-47-8
CAS 1398065-47-8 is the registry number for 2,4-Dichlorotoluene-3,5,6-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,3-dichloro-2,4,5-trideuterio-6-methylbenzene (CAS 1398065-47-8) is a chemical compound with the molecular formula C7H6Cl2 and a molecular weight of 164.04 g/mol. IUPAC name: 1,3-dichloro-2,4,5-trideuterio-6-methylbenzene. InChIKey: FUNUTBJJKQIVSY-NRUYWUNFSA-N.
| Molecular formula | C7H6Cl2 |
|---|---|
| Molecular weight | 164.04 g/mol |
| IUPAC name | 1,3-dichloro-2,4,5-trideuterio-6-methylbenzene |
| InChIKey | FUNUTBJJKQIVSY-NRUYWUNFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)Cl)[2H])Cl)[2H] |
Computed by PubChem (NCBI)