CAS 1398065-69-4 appears in our catalog under these names: Roflumilast-d4, Roflumilast-d4 (cyclopropyl-2,2,3,3-d4), 98 atom % D, min 98% Chemical Purity, Roflumilast-d4, >95% (HPLC), Roflumilast–d4, Roflumilast-d4, 97.26%. Offered by: Chemat Brand, CDN, TRC, GLPBio, Biosynth. Available pack sizes: on request, 0,01g, 0,005g, 10mg, 1mg, 5mg, 500μg, 25mg.
N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]benzamide (CAS 1398065-69-4) is a chemical compound with the molecular formula C17H14Cl2F2N2O3 and a molecular weight of 407.2 g/mol. IUPAC name: N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]benzamide. InChIKey: MNDBXUUTURYVHR-LNLMKGTHSA-N.
| Molecular formula | C17H14Cl2F2N2O3 |
|---|---|
| Molecular weight | 407.2 g/mol |
| IUPAC name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]benzamide |
| InChIKey | MNDBXUUTURYVHR-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])COC2=C(C=CC(=C2)C(=O)NC3=C(C=NC=C3Cl)Cl)OC(F)F)[2H] |
Computed by PubChem (NCBI)