Products 2368178-28-1
CAS 2368178-28-1 is the registry number for 3-Cyclobutoxy-N-(3,5-dichloropyridin-4-yl)-4-(difluoromethoxy)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-cyclobutyloxy-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)benzamide (CAS 2368178-28-1) is a chemical compound with the molecular formula C17H14Cl2F2N2O3 and a molecular weight of 403.2 g/mol. IUPAC name: 3-cyclobutyloxy-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)benzamide. InChIKey: NZEVRSNHPNIGSW-UHFFFAOYSA-N.
| Molecular formula | C17H14Cl2F2N2O3 |
|---|---|
| Molecular weight | 403.2 g/mol |
| IUPAC name | 3-cyclobutyloxy-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)benzamide |
| InChIKey | NZEVRSNHPNIGSW-UHFFFAOYSA-N |
| SMILES | C1CC(C1)OC2=C(C=CC(=C2)C(=O)NC3=C(C=NC=C3Cl)Cl)OC(F)F |
Computed by PubChem (NCBI)