Products 1398065-72-9
CAS 1398065-72-9 appears in our catalog under these names: 3-(3,4-Dimethoxy-d6-phenyl)propionic-2,2,3,3-d4 Acid, 99 atom % D, min 98% Chemical Purity, 3-(3,4-Dimethoxyphenyl)propanoic acid-d10, 98.99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5 mg, 1 mg.
3-[3,4-bis(trideuteriomethoxy)phenyl]-2,2,3,3-tetradeuteriopropanoic acid (CAS 1398065-72-9) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 220.29 g/mol. IUPAC name: 3-[3,4-bis(trideuteriomethoxy)phenyl]-2,2,3,3-tetradeuteriopropanoic acid. InChIKey: LHHKQWQTBCTDQM-DBFNBSHFSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 3-[3,4-bis(trideuteriomethoxy)phenyl]-2,2,3,3-tetradeuteriopropanoic acid |
| InChIKey | LHHKQWQTBCTDQM-DBFNBSHFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C([2H])([2H])C([2H])([2H])C(=O)O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)