Products 1398065-81-0
CAS 1398065-81-0 appears in our catalog under these names: Phthalic Acid Bis(3,7-dimethyloctyl) Ester-d4, Bis(3,7-dimethyl-1-octyl) Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g, 10 mg, 100 mg.
Bis(3,7-dimethyloctyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 1398065-81-0) is a chemical compound with the molecular formula C28H46O4 and a molecular weight of 450.7 g/mol. IUPAC name: bis(3,7-dimethyloctyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: KVZQPXDGIYJYLU-HLUUBPERSA-N.
| Molecular formula | C28H46O4 |
|---|---|
| Molecular weight | 450.7 g/mol |
| IUPAC name | bis(3,7-dimethyloctyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | KVZQPXDGIYJYLU-HLUUBPERSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCC(C)CCCC(C)C)C(=O)OCCC(C)CCCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)