Products 1398066-08-4
CAS 1398066-08-4 appears in our catalog under these names: Urapidil-d3 (methoxy-d3), Urapidil-d3 (methoxy-d3), 99 atom % D, min 98% Chemical Purity, Urapidil–d3, Urapidil-d3, 99.93%. Offered by: Chemat Brand, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 0,01g, 0,005g, 1mg, 1 mg.
1,3-dimethyl-6-[3-[4-[2-(trideuteriomethoxy)phenyl]piperazin-1-yl]propylamino]pyrimidine-2,4-dione (CAS 1398066-08-4) is a chemical compound with the molecular formula C20H29N5O3 and a molecular weight of 390.5 g/mol. IUPAC name: 1,3-dimethyl-6-[3-[4-[2-(trideuteriomethoxy)phenyl]piperazin-1-yl]propylamino]pyrimidine-2,4-dione. InChIKey: ICMGLRUYEQNHPF-HPRDVNIFSA-N.
| Molecular formula | C20H29N5O3 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 1,3-dimethyl-6-[3-[4-[2-(trideuteriomethoxy)phenyl]piperazin-1-yl]propylamino]pyrimidine-2,4-dione |
| InChIKey | ICMGLRUYEQNHPF-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1N2CCN(CC2)CCCNC3=CC(=O)N(C(=O)N3C)C |
Computed by PubChem (NCBI)
Synonyms:
Urapidil-d3, Urapidil-d3 (methoxy-d3)