Products 34661-79-5
CAS 34661-79-5 appears in our catalog under these names: Urapidil Impurity 2, Urapidil Impurity 14, Urapidil Impurity 13, 2-Demethoxy-4-methoxy Urapidil, >95% (HPLC), 2-Demethoxy-4-methoxy urapidil. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethylpyrimidine-2,4-dione (CAS 34661-79-5) is a chemical compound with the molecular formula C20H29N5O3 and a molecular weight of 387.5 g/mol. IUPAC name: 6-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethylpyrimidine-2,4-dione. InChIKey: FSIVWMBBAZRTCH-UHFFFAOYSA-N.
| Molecular formula | C20H29N5O3 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 6-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethylpyrimidine-2,4-dione |
| InChIKey | FSIVWMBBAZRTCH-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=O)N(C1=O)C)NCCCN2CCN(CC2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)