Products 1797509-92-2

CAS 1797509-92-2 is the registry number for Cilostazol Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[2-amino-5-[4-(1-cyclohexyltetrazol-5-yl)butoxy]phenyl]propanoic acid (CAS 1797509-92-2) is a chemical compound with the molecular formula C20H29N5O3 and a molecular weight of 387.5 g/mol. IUPAC name: 3-[2-amino-5-[4-(1-cyclohexyltetrazol-5-yl)butoxy]phenyl]propanoic acid. InChIKey: KLRKLACKORDVFF-UHFFFAOYSA-N.

Identity
Molecular formulaC20H29N5O3
Molecular weight387.5 g/mol
IUPAC name3-[2-amino-5-[4-(1-cyclohexyltetrazol-5-yl)butoxy]phenyl]propanoic acid
InChIKeyKLRKLACKORDVFF-UHFFFAOYSA-N
SMILESC1CCC(CC1)N2C(=NN=N2)CCCCOC3=CC(=C(C=C3)N)CCC(=O)O

Computed by PubChem (NCBI)