CAS 1398066-13-1 appears in our catalog under these names: Bis(4-methyl-2-pentyl) Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Phthalic acid, bis-4-methyl-2-pentyl ester D4, Bis(4–methyl–2–pentyl) phthalate–d4, Bis(4-methyl-2-pentyl) phthalate-d4. Offered by: CDN, Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 25mg, 10mg, 5mg, 50mg, 1 mg.
Bis(4-methylpentan-2-yl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 1398066-13-1) is a chemical compound with the molecular formula C20H30O4 and a molecular weight of 338.5 g/mol. IUPAC name: bis(4-methylpentan-2-yl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: UAFXUVUVOTXFND-ULDPCNCHSA-N.
| Molecular formula | C20H30O4 |
|---|---|
| Molecular weight | 338.5 g/mol |
| IUPAC name | bis(4-methylpentan-2-yl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | UAFXUVUVOTXFND-ULDPCNCHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC(C)CC(C)C)C(=O)OC(C)CC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)