CAS 1398112-31-6 appears in our catalog under these names: (S)-3-Amino(piperidine-3-d1)-2,6-dione HCl, 94 atom % D, min 98% Chemical Purity, (S)-3-Aminopiperidine-2,6-dione-d1 hydrochloride. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 100 mg, 50 mg.
(3S)-3-amino-3-deuteriopiperidine-2,6-dione;hydrochloride (CAS 1398112-31-6) is a chemical compound with the molecular formula C5H9ClN2O2 and a molecular weight of 165.59 g/mol. IUPAC name: (3S)-3-amino-3-deuteriopiperidine-2,6-dione;hydrochloride. InChIKey: YCPULGHBTPQLRH-QFRCSKALSA-N.
| Molecular formula | C5H9ClN2O2 |
|---|---|
| Molecular weight | 165.59 g/mol |
| IUPAC name | (3S)-3-amino-3-deuteriopiperidine-2,6-dione;hydrochloride |
| InChIKey | YCPULGHBTPQLRH-QFRCSKALSA-N |
| SMILES | [2H][C@@]1(CCC(=O)NC1=O)N.Cl |
Computed by PubChem (NCBI)