Products 2686-86-4

CAS 2686-86-4 is the registry number for 3-Aminopiperidine-2,6-dione hydrochloride, 99%, 99%. Offered by: Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg.

Structural formula: {0} (CAS {1})

3-aminopiperidine-2,6-dione;hydrochloride (CAS 2686-86-4) is a chemical compound with the molecular formula C5H9ClN2O2 and a molecular weight of 164.59 g/mol. IUPAC name: 3-aminopiperidine-2,6-dione;hydrochloride. InChIKey: YCPULGHBTPQLRH-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClN2O2
Molecular weight164.59 g/mol
IUPAC name3-aminopiperidine-2,6-dione;hydrochloride
InChIKeyYCPULGHBTPQLRH-UHFFFAOYSA-N
SMILESC1CC(=O)NC(=O)C1N.Cl

Computed by PubChem (NCBI)