Products 1398503-83-7

CAS 1398503-83-7 is the registry number for 4-(Methoxy-d3)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

[4-(trideuteriomethoxy)phenyl]boronic acid (CAS 1398503-83-7) is a chemical compound with the molecular formula C7H9BO3 and a molecular weight of 154.98 g/mol. IUPAC name: [4-(trideuteriomethoxy)phenyl]boronic acid. InChIKey: VOAAEKKFGLPLLU-FIBGUPNXSA-N.

Identity
Molecular formulaC7H9BO3
Molecular weight154.98 g/mol
IUPAC name[4-(trideuteriomethoxy)phenyl]boronic acid
InChIKeyVOAAEKKFGLPLLU-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])OC1=CC=C(C=C1)B(O)O

Computed by PubChem (NCBI)