CAS 2241867-06-9 is the registry number for 4-(Methoxyphenyl-d7)-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
[2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]boronic acid (CAS 2241867-06-9) is a chemical compound with the molecular formula C7H9BO3 and a molecular weight of 159.00 g/mol. IUPAC name: [2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]boronic acid. InChIKey: VOAAEKKFGLPLLU-AAYPNNLASA-N.
| Molecular formula | C7H9BO3 |
|---|---|
| Molecular weight | 159.00 g/mol |
| IUPAC name | [2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]boronic acid |
| InChIKey | VOAAEKKFGLPLLU-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1B(O)O)[2H])[2H])OC([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)