Products 2241867-05-8
CAS 2241867-05-8 appears in our catalog under these names: 3-(Methoxy-d3)phenylboronic acid, 98%, 3-(Methoxy-d3)phenylboronic acid, 98%, 98%, 3-Methoxybenzeneboronic acid-d3. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 50mg, 50 mg, 100 mg, 250 mg.
[3-(trideuteriomethoxy)phenyl]boronic acid (CAS 2241867-05-8) is a chemical compound with the molecular formula C7H9BO3 and a molecular weight of 154.98 g/mol. IUPAC name: [3-(trideuteriomethoxy)phenyl]boronic acid. InChIKey: NLLGFYPSWCMUIV-FIBGUPNXSA-N.
| Molecular formula | C7H9BO3 |
|---|---|
| Molecular weight | 154.98 g/mol |
| IUPAC name | [3-(trideuteriomethoxy)phenyl]boronic acid |
| InChIKey | NLLGFYPSWCMUIV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1)B(O)O |
Computed by PubChem (NCBI)