CAS 1398504-18-1 is the registry number for 7-Bromo-5-fluoro-(1,2,4)triazolo(1,5-a)pyridin-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
7-bromo-5-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1398504-18-1) is a chemical compound with the molecular formula C6H4BrFN4 and a molecular weight of 231.03 g/mol. IUPAC name: 7-bromo-5-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: CFYZGYMMOWDWJA-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN4 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | 7-bromo-5-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | CFYZGYMMOWDWJA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N2C1=NC(=N2)N)F)Br |
Computed by PubChem (NCBI)