CAS 1360650-52-7 is the registry number for 7-Bromo-2-fluoropyrrolo(2,1-f)(1,2,4)triazin-4-amine, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 100mg.
7-bromo-2-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine (CAS 1360650-52-7) is a chemical compound with the molecular formula C6H4BrFN4 and a molecular weight of 231.03 g/mol. IUPAC name: 7-bromo-2-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine. InChIKey: MDLCXCFFNSWYNV-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN4 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | 7-bromo-2-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine |
| InChIKey | MDLCXCFFNSWYNV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C(=C1)Br)F)N |
Computed by PubChem (NCBI)