CAS 1257705-51-3 appears in our catalog under these names: 8–Bromo–6–fluoro–(1,2,4)triazolo(1,5–a)pyridin–2–amine, 8-Bromo-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 98%, 98%, 8-Bromo-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
8-bromo-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1257705-51-3) is a chemical compound with the molecular formula C6H4BrFN4 and a molecular weight of 231.03 g/mol. IUPAC name: 8-bromo-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: SPRFTNQQUSECLU-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN4 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | 8-bromo-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | SPRFTNQQUSECLU-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=NN2C=C1F)N)Br |
Computed by PubChem (NCBI)