CAS 2368204-19-5 is the registry number for 7-Bromo-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine (CAS 2368204-19-5) is a chemical compound with the molecular formula C6H4BrFN4 and a molecular weight of 231.03 g/mol. IUPAC name: 7-bromo-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine. InChIKey: FUBYIGPQVIHSMY-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN4 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | 7-bromo-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine |
| InChIKey | FUBYIGPQVIHSMY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC=NN2C(=C1F)Br)N |
Computed by PubChem (NCBI)