CAS 13988-67-5 appears in our catalog under these names: 4,4-Dimethyl-1-phenylpentane-1,3-dione, 95%, 4,4-Dimethyl-1-phenylpentane-1,3-dione, 98%, 4,4-Dimethyl-1-phenylpentane-1,3-dione, 99% , 4,4-dimethyl-1-phenyl-1,3-pentanedione. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 25g, 5g.
4,4-dimethyl-1-phenylpentane-1,3-dione (CAS 13988-67-5) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 4,4-dimethyl-1-phenylpentane-1,3-dione. InChIKey: HORVLKADAZQYRS-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 4,4-dimethyl-1-phenylpentane-1,3-dione |
| InChIKey | HORVLKADAZQYRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)