CAS 139892-53-8 is the registry number for (R)–2–(Chloromethyl)–1,4–dioxaspiro(4·5)decane. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
(3R)-3-(chloromethyl)-1,4-dioxaspiro[4.5]decane (CAS 139892-53-8) is a chemical compound with the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. IUPAC name: (3R)-3-(chloromethyl)-1,4-dioxaspiro[4.5]decane. InChIKey: XGQRXAWHKWEULC-QMMMGPOBSA-N.
| Molecular formula | C9H15ClO2 |
|---|---|
| Molecular weight | 190.67 g/mol |
| IUPAC name | (3R)-3-(chloromethyl)-1,4-dioxaspiro[4.5]decane |
| InChIKey | XGQRXAWHKWEULC-QMMMGPOBSA-N |
| SMILES | C1CCC2(CC1)OC[C@@H](O2)CCl |
Computed by PubChem (NCBI)