Products 72448-93-2

CAS 72448-93-2 is the registry number for 7-Chloro-trans-2-hepenoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl (E)-7-chlorohept-2-enoate (CAS 72448-93-2) is a chemical compound with the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. IUPAC name: ethyl (E)-7-chlorohept-2-enoate. InChIKey: QRJDSTPXJIADET-FNORWQNLSA-N.

Identity
Molecular formulaC9H15ClO2
Molecular weight190.67 g/mol
IUPAC nameethyl (E)-7-chlorohept-2-enoate
InChIKeyQRJDSTPXJIADET-FNORWQNLSA-N
SMILESCCOC(=O)/C=C/CCCCCl

Computed by PubChem (NCBI)