CAS 1399655-37-8 appears in our catalog under these names: 5-Bromo-1-(2-chlorophenyl)-1H-pyrazole-4-carboxylic acid, 98%, 98%, 5-Bromo-1-(2-chlorophenyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
5-bromo-1-(2-chlorophenyl)pyrazole-4-carboxylic acid (CAS 1399655-37-8) is a chemical compound with the molecular formula C10H6BrClN2O2 and a molecular weight of 301.52 g/mol. IUPAC name: 5-bromo-1-(2-chlorophenyl)pyrazole-4-carboxylic acid. InChIKey: ARMZTVWWFUBKOA-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2O2 |
|---|---|
| Molecular weight | 301.52 g/mol |
| IUPAC name | 5-bromo-1-(2-chlorophenyl)pyrazole-4-carboxylic acid |
| InChIKey | ARMZTVWWFUBKOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=C(C=N2)C(=O)O)Br)Cl |
Computed by PubChem (NCBI)