CAS 2095181-34-1 is the registry number for methyl 8-bromo-3-chloroquinoxaline-6-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 8-bromo-3-chloroquinoxaline-6-carboxylate (CAS 2095181-34-1) is a chemical compound with the molecular formula C10H6BrClN2O2 and a molecular weight of 301.52 g/mol. IUPAC name: methyl 8-bromo-3-chloroquinoxaline-6-carboxylate. InChIKey: YVHZBLZGGMJLEM-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2O2 |
|---|---|
| Molecular weight | 301.52 g/mol |
| IUPAC name | methyl 8-bromo-3-chloroquinoxaline-6-carboxylate |
| InChIKey | YVHZBLZGGMJLEM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NC(=CN=C2C(=C1)Br)Cl |
Computed by PubChem (NCBI)