CAS 914457-22-0 is the registry number for 4–bromo–1–(3–chloropyridin–2–yl)–1H–pyrrole–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 200mg.
4-bromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid (CAS 914457-22-0) is a chemical compound with the molecular formula C10H6BrClN2O2 and a molecular weight of 301.52 g/mol. IUPAC name: 4-bromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid. InChIKey: PMMARSKKRHWEDE-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2O2 |
|---|---|
| Molecular weight | 301.52 g/mol |
| IUPAC name | 4-bromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid |
| InChIKey | PMMARSKKRHWEDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=C(C=C2C(=O)O)Br)Cl |
Computed by PubChem (NCBI)