CAS 14006-54-3 appears in our catalog under these names: 3-Chloro-1-benzothiophene-2-carbaldehyde, 98%, 3-Chlorobenzo[b]thiophene-2-carbaldehyde, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg.
3-chloro-1-benzothiophene-2-carbaldehyde (CAS 14006-54-3) is a chemical compound with the molecular formula C9H5ClOS and a molecular weight of 196.65 g/mol. IUPAC name: 3-chloro-1-benzothiophene-2-carbaldehyde. InChIKey: UFTPKLPCVLXBQY-UHFFFAOYSA-N.
| Molecular formula | C9H5ClOS |
|---|---|
| Molecular weight | 196.65 g/mol |
| IUPAC name | 3-chloro-1-benzothiophene-2-carbaldehyde |
| InChIKey | UFTPKLPCVLXBQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C=O)Cl |
Computed by PubChem (NCBI)