CAS 39827-11-7 appears in our catalog under these names: Benzo[b]thiophene-2-carbonyl chloride, 95%, Benzo(b)thiophene–2–carbonylchloride, Benzo[b]thiophene-2-carbonyl Chloride, >98.0%(T), Benzo[b]thiophene-2-carbonyl chloride 95%, Benzo(b)thiophene-2-carbonyl chloride. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
1-benzothiophene-2-carbonyl chloride (CAS 39827-11-7) is a chemical compound with the molecular formula C9H5ClOS and a molecular weight of 196.65 g/mol. IUPAC name: 1-benzothiophene-2-carbonyl chloride. InChIKey: DNGLRCHMGDDHNC-UHFFFAOYSA-N.
| Molecular formula | C9H5ClOS |
|---|---|
| Molecular weight | 196.65 g/mol |
| IUPAC name | 1-benzothiophene-2-carbonyl chloride |
| InChIKey | DNGLRCHMGDDHNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C(=O)Cl |
Computed by PubChem (NCBI)