CAS 39827-12-8 appears in our catalog under these names: Benzo[b]thiophene-3-carbonyl chloride, ≥97%, ≥97%, Benzo[b]thiophene-3-carbonyl chloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-benzothiophene-3-carbonyl chloride (CAS 39827-12-8) is a chemical compound with the molecular formula C9H5ClOS and a molecular weight of 196.65 g/mol. IUPAC name: 1-benzothiophene-3-carbonyl chloride. InChIKey: GSMXWLPUJAYDHX-UHFFFAOYSA-N.
| Molecular formula | C9H5ClOS |
|---|---|
| Molecular weight | 196.65 g/mol |
| IUPAC name | 1-benzothiophene-3-carbonyl chloride |
| InChIKey | GSMXWLPUJAYDHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C(=O)Cl |
Computed by PubChem (NCBI)