Products 39827-12-8

CAS 39827-12-8 appears in our catalog under these names: Benzo[b]thiophene-3-carbonyl chloride, ≥97%, ≥97%, Benzo[b]thiophene-3-carbonyl chloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-benzothiophene-3-carbonyl chloride (CAS 39827-12-8) is a chemical compound with the molecular formula C9H5ClOS and a molecular weight of 196.65 g/mol. IUPAC name: 1-benzothiophene-3-carbonyl chloride. InChIKey: GSMXWLPUJAYDHX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClOS
Molecular weight196.65 g/mol
IUPAC name1-benzothiophene-3-carbonyl chloride
InChIKeyGSMXWLPUJAYDHX-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CS2)C(=O)Cl

Computed by PubChem (NCBI)